About N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide
N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide (PubChem CID 162660019) has the molecular formula C25H20N4O3
and a molecular weight of 424.46 g/mol. Its IUPAC name is N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide.
Molecular Properties
| Compound Name | N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide |
| PubChem CID | 162660019 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccccc1C(=O)Nc1n[nH]c2cc(-c3ccc4c(c3)CCO4)ccc12 |
| InChI | InChI=1S/C25H20N4O3/c1-2-23(30)26-20-6-4-3-5-19(20)25(31)27-24-18-9-7-16(14-21(18)28-29-24)15-8-10-22-17(13-15)11-12-32-22/h2-10,13-14H,1,11-12H2,(H,26,30)(H2,27,28,29,31) |
| InChIKey | JCNYQKHYAQMPDL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide?
The IUPAC name of N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide (CID 162660019) is N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide.
What is the SMILES notation for N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide?
The canonical SMILES for N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide is C=CC(=O)Nc1ccccc1C(=O)Nc1n[nH]c2cc(-c3ccc4c(c3)CCO4)ccc12.
What is the InChIKey of N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide?
The InChIKey is JCNYQKHYAQMPDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N4O3/c1-2-23(30)26-20-6-4-3-5-19(20)25(31)27-24-18-9-7-16(14-21(18)28-29-24)15-8-10-22-17(13-15)11-12-32-22/h2-10,13-14H,1,11-12H2,(H,26,30)(H2,27,28,29,31).
What are the key properties of N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide?
N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide has a molecular weight of 424.46 g/mol, XLogP of 4.54, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide is sourced from PubChem (CID 162660019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).