C21H13F4N3OS — CID 87678026
2,3,4,5-tetrafluoro-N-[6-(2-methylsulfanylphenyl)-1H-indazol-3-yl]benzamide (PubChem CID 87678026) has the molecular formula C21H13F4N3OS and a molecular weight of 431.41 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[6-(2-methylsulfanylphenyl)-1H-indazol-3-yl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[6-(2-methylsulfanylphenyl)-1H-indazol-3-yl]benzamide |
|---|---|
| PubChem CID | 87678026 |
| Molecular Formula | C21H13F4N3OS |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[6-(2-methylsulfanylphenyl)-1H-indazol-3-yl]benzamide |
| SMILES | CSc1ccccc1-c1ccc2c(NC(=O)c3cc(F)c(F)c(F)c3F)n[nH]c2c1 |
| InChI | InChI=1S/C21H13F4N3OS/c1-30-16-5-3-2-4-11(16)10-6-7-12-15(8-10)27-28-20(12)26-21(29)13-9-14(22)18(24)19(25)17(13)23/h2-9H,1H3,(H2,26,27,28,29) |
| InChIKey | IXUDPKVAFYYIET-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|