C22H19N3O — CID 69059504
N-[6-(2,6-dimethylphenyl)-1H-indazol-3-yl]benzamide (PubChem CID 69059504) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[6-(2,6-dimethylphenyl)-1H-indazol-3-yl]benzamide.
| Compound Name | N-[6-(2,6-dimethylphenyl)-1H-indazol-3-yl]benzamide |
|---|---|
| PubChem CID | 69059504 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-[6-(2,6-dimethylphenyl)-1H-indazol-3-yl]benzamide |
| SMILES | Cc1cccc(C)c1-c1ccc2c(NC(=O)c3ccccc3)n[nH]c2c1 |
| InChI | InChI=1S/C22H19N3O/c1-14-7-6-8-15(2)20(14)17-11-12-18-19(13-17)24-25-21(18)23-22(26)16-9-4-3-5-10-16/h3-13H,1-2H3,(H2,23,24,25,26) |
| InChIKey | GZGBEPQSCCETJG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |