C23H18ClFN4O3 — CID 175103815
3-(2-amino-1-chloro-2-oxoethyl)-N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]benzamide (PubChem CID 175103815) has the molecular formula C23H18ClFN4O3 and a molecular weight of 452.87 g/mol. Its IUPAC name is 3-(2-amino-1-chloro-2-oxoethyl)-N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]benzamide.
| Compound Name | 3-(2-amino-1-chloro-2-oxoethyl)-N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]benzamide |
|---|---|
| PubChem CID | 175103815 |
| Molecular Formula | C23H18ClFN4O3 |
| Molecular Weight | 452.87 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 3-(2-amino-1-chloro-2-oxoethyl)-N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]benzamide |
| SMILES | COc1ccc(F)c(-c2ccc3c(NC(=O)c4cccc(C(Cl)C(N)=O)c4)n[nH]c3c2)c1 |
| InChI | InChI=1S/C23H18ClFN4O3/c1-32-15-6-8-18(25)17(11-15)12-5-7-16-19(10-12)28-29-22(16)27-23(31)14-4-2-3-13(9-14)20(24)21(26)30/h2-11,20H,1H3,(H2,26,30)(H2,27,28,29,31) |
| InChIKey | AZQNYIIMYXERKL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|