C10H12N4OS — CID 99992879
2-(3-amino-5-thiophen-2-yl-1H-pyrazol-4-yl)-N-methylacetamide (PubChem CID 99992879) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-(3-amino-5-thiophen-2-yl-1H-pyrazol-4-yl)-N-methylacetamide.
| Compound Name | 2-(3-amino-5-thiophen-2-yl-1H-pyrazol-4-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 99992879 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-(3-amino-5-thiophen-2-yl-1H-pyrazol-4-yl)-N-methylacetamide |
| SMILES | CNC(=O)Cc1c(N)n[nH]c1-c1cccs1 |
| InChI | InChI=1S/C10H12N4OS/c1-12-8(15)5-6-9(13-14-10(6)11)7-3-2-4-16-7/h2-4H,5H2,1H3,(H,12,15)(H3,11,13,14) |
| InChIKey | LGGKQXRVDCHPKZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |