C9H10BrN3S — CID 116825997
4-bromo-N,N-dimethyl-5-thiophen-2-yl-1H-pyrazol-3-amine (PubChem CID 116825997) has the molecular formula C9H10BrN3S and a molecular weight of 272.17 g/mol. Its IUPAC name is 4-bromo-N,N-dimethyl-5-thiophen-2-yl-1H-pyrazol-3-amine.
| Compound Name | 4-bromo-N,N-dimethyl-5-thiophen-2-yl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 116825997 |
| Molecular Formula | C9H10BrN3S |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 4-bromo-N,N-dimethyl-5-thiophen-2-yl-1H-pyrazol-3-amine |
| SMILES | CN(C)c1n[nH]c(-c2cccs2)c1Br |
| InChI | InChI=1S/C9H10BrN3S/c1-13(2)9-7(10)8(11-12-9)6-4-3-5-14-6/h3-5H,1-2H3,(H,11,12) |
| InChIKey | PLOBDTPWEQIQFO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |