C12H7BrN2S2 — CID 134693324
5-bromo-4,6-dithiophen-2-ylpyrimidine (PubChem CID 134693324) has the molecular formula C12H7BrN2S2 and a molecular weight of 323.24 g/mol. Its IUPAC name is 5-bromo-4,6-dithiophen-2-ylpyrimidine.
| Compound Name | 5-bromo-4,6-dithiophen-2-ylpyrimidine |
|---|---|
| PubChem CID | 134693324 |
| Molecular Formula | C12H7BrN2S2 |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | 5-bromo-4,6-dithiophen-2-ylpyrimidine |
| SMILES | Brc1c(-c2cccs2)ncnc1-c1cccs1 |
| InChI | InChI=1S/C12H7BrN2S2/c13-10-11(8-3-1-5-16-8)14-7-15-12(10)9-4-2-6-17-9/h1-7H |
| InChIKey | JZIVRGAXQWDEPG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |