C15H9N3S2 — CID 4638749
2,3-dithiophen-2-ylpyrido[2,3-b]pyrazine (PubChem CID 4638749) has the molecular formula C15H9N3S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 2,3-dithiophen-2-ylpyrido[2,3-b]pyrazine.
| Compound Name | 2,3-dithiophen-2-ylpyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 4638749 |
| Molecular Formula | C15H9N3S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2,3-dithiophen-2-ylpyrido[2,3-b]pyrazine |
| SMILES | c1csc(-c2nc3cccnc3nc2-c2cccs2)c1 |
| InChI | InChI=1S/C15H9N3S2/c1-4-10-15(16-7-1)18-14(12-6-3-9-20-12)13(17-10)11-5-2-8-19-11/h1-9H |
| InChIKey | DVFOTSWUXNMZFT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |