C16H10N2OS2 — CID 142989779
2,3-dithiophen-2-ylquinoxalin-6-ol (PubChem CID 142989779) has the molecular formula C16H10N2OS2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2,3-dithiophen-2-ylquinoxalin-6-ol.
| Compound Name | 2,3-dithiophen-2-ylquinoxalin-6-ol |
|---|---|
| PubChem CID | 142989779 |
| Molecular Formula | C16H10N2OS2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2,3-dithiophen-2-ylquinoxalin-6-ol |
| SMILES | Oc1ccc2nc(-c3cccs3)c(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C16H10N2OS2/c19-10-5-6-11-12(9-10)18-16(14-4-2-8-21-14)15(17-11)13-3-1-7-20-13/h1-9,19H |
| InChIKey | LBTLOMFROYZTKQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |