C24H22N4OS — CID 11258496
N-(2-piperidin-1-yl-3-thiophen-2-ylquinoxalin-6-yl)benzamide (PubChem CID 11258496) has the molecular formula C24H22N4OS and a molecular weight of 414.53 g/mol. Its IUPAC name is N-(2-piperidin-1-yl-3-thiophen-2-ylquinoxalin-6-yl)benzamide.
| Compound Name | N-(2-piperidin-1-yl-3-thiophen-2-ylquinoxalin-6-yl)benzamide |
|---|---|
| PubChem CID | 11258496 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-(2-piperidin-1-yl-3-thiophen-2-ylquinoxalin-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2nc(N3CCCCC3)c(-c3cccs3)nc2c1)c1ccccc1 |
| InChI | InChI=1S/C24H22N4OS/c29-24(17-8-3-1-4-9-17)25-18-11-12-19-20(16-18)26-22(21-10-7-15-30-21)23(27-19)28-13-5-2-6-14-28/h1,3-4,7-12,15-16H,2,5-6,13-14H2,(H,25,29) |
| InChIKey | IEKQEBDEYIOVNI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |