C27H22N4OS2 — CID 2925607
N-(2,3-dithiophen-2-ylquinoxalin-6-yl)-3-phenylpyrrolidine-1-carboxamide (PubChem CID 2925607) has the molecular formula C27H22N4OS2 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-(2,3-dithiophen-2-ylquinoxalin-6-yl)-3-phenylpyrrolidine-1-carboxamide.
| Compound Name | N-(2,3-dithiophen-2-ylquinoxalin-6-yl)-3-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 2925607 |
| Molecular Formula | C27H22N4OS2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-(2,3-dithiophen-2-ylquinoxalin-6-yl)-3-phenylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc2nc(-c3cccs3)c(-c3cccs3)nc2c1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C27H22N4OS2/c32-27(31-13-12-19(17-31)18-6-2-1-3-7-18)28-20-10-11-21-22(16-20)30-26(24-9-5-15-34-24)25(29-21)23-8-4-14-33-23/h1-11,14-16,19H,12-13,17H2,(H,28,32) |
| InChIKey | ALAOGZCWAGPSFY-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |