C24H28N4O — CID 10237485
N-(4-amino-2-propan-2-ylquinolin-6-yl)-4-phenylpiperidine-1-carboxamide (PubChem CID 10237485) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is N-(4-amino-2-propan-2-ylquinolin-6-yl)-4-phenylpiperidine-1-carboxamide.
| Compound Name | N-(4-amino-2-propan-2-ylquinolin-6-yl)-4-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 10237485 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-(4-amino-2-propan-2-ylquinolin-6-yl)-4-phenylpiperidine-1-carboxamide |
| SMILES | CC(C)c1cc(N)c2cc(NC(=O)N3CCC(c4ccccc4)CC3)ccc2n1 |
| InChI | InChI=1S/C24H28N4O/c1-16(2)23-15-21(25)20-14-19(8-9-22(20)27-23)26-24(29)28-12-10-18(11-13-28)17-6-4-3-5-7-17/h3-9,14-16,18H,10-13H2,1-2H3,(H2,25,27)(H,26,29) |
| InChIKey | RPZFZJVHODTXLH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |