C38H30N4O2S — CID 126338463
O-[4-[(2,3-diphenylquinoxalin-6-yl)carbamoyl]phenyl] (3S)-3-phenylpyrrolidine-1-carbothioate (PubChem CID 126338463) has the molecular formula C38H30N4O2S and a molecular weight of 606.75 g/mol. Its IUPAC name is O-[4-[(2,3-diphenylquinoxalin-6-yl)carbamoyl]phenyl] (3S)-3-phenylpyrrolidine-1-carbothioate.
| Compound Name | O-[4-[(2,3-diphenylquinoxalin-6-yl)carbamoyl]phenyl] (3S)-3-phenylpyrrolidine-1-carbothioate |
|---|---|
| PubChem CID | 126338463 |
| Molecular Formula | C38H30N4O2S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | O-[4-[(2,3-diphenylquinoxalin-6-yl)carbamoyl]phenyl] (3S)-3-phenylpyrrolidine-1-carbothioate |
| SMILES | O=C(Nc1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1)c1ccc(OC(=S)N2CC[C@@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C38H30N4O2S/c43-37(29-16-19-32(20-17-29)44-38(45)42-23-22-30(25-42)26-10-4-1-5-11-26)39-31-18-21-33-34(24-31)41-36(28-14-8-3-9-15-28)35(40-33)27-12-6-2-7-13-27/h1-21,24,30H,22-23,25H2,(H,39,43)/t30-/m1/s1 |
| InChIKey | HPEZEEHUXDVXRS-SSEXGKCCSA-N |
| XLogP | 8.37 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|