C27H25Cl2N3O — CID 142764266
N-[3-chloro-2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]benzamide;hydrochloride (PubChem CID 142764266) has the molecular formula C27H25Cl2N3O and a molecular weight of 478.42 g/mol. Its IUPAC name is N-[3-chloro-2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]benzamide;hydrochloride.
| Compound Name | N-[3-chloro-2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 142764266 |
| Molecular Formula | C27H25Cl2N3O |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[3-chloro-2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]benzamide;hydrochloride |
| SMILES | Cc1nc2ccc(NC(=O)c3ccccc3)cc2c(N2CCC(c3ccccc3)C2)c1Cl.Cl |
| InChI | InChI=1S/C27H24ClN3O.ClH/c1-18-25(28)26(31-15-14-21(17-31)19-8-4-2-5-9-19)23-16-22(12-13-24(23)29-18)30-27(32)20-10-6-3-7-11-20;/h2-13,16,21H,14-15,17H2,1H3,(H,30,32);1H |
| InChIKey | BKSODUSOUMKZBI-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |