C24H21ClN2O3 — CID 93070135
5-[(3-chlorobenzoyl)amino]-2-[(3S)-3-phenylpyrrolidin-1-yl]benzoic acid (PubChem CID 93070135) has the molecular formula C24H21ClN2O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is 5-[(3-chlorobenzoyl)amino]-2-[(3S)-3-phenylpyrrolidin-1-yl]benzoic acid.
| Compound Name | 5-[(3-chlorobenzoyl)amino]-2-[(3S)-3-phenylpyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 93070135 |
| Molecular Formula | C24H21ClN2O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 5-[(3-chlorobenzoyl)amino]-2-[(3S)-3-phenylpyrrolidin-1-yl]benzoic acid |
| SMILES | O=C(Nc1ccc(N2CC[C@@H](c3ccccc3)C2)c(C(=O)O)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H21ClN2O3/c25-19-8-4-7-17(13-19)23(28)26-20-9-10-22(21(14-20)24(29)30)27-12-11-18(15-27)16-5-2-1-3-6-16/h1-10,13-14,18H,11-12,15H2,(H,26,28)(H,29,30)/t18-/m1/s1 |
| InChIKey | DPCPVHOZBARIGZ-GOSISDBHSA-N |
| XLogP | 5.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|