C25H29ClF3N3O5 — CID 146060832
5-[(3-chlorobenzoyl)amino]-2-(4-pentan-2-ylpiperazin-1-yl)benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060832) has the molecular formula C25H29ClF3N3O5 and a molecular weight of 543.97 g/mol. Its IUPAC name is 5-[(3-chlorobenzoyl)amino]-2-(4-pentan-2-ylpiperazin-1-yl)benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(3-chlorobenzoyl)amino]-2-(4-pentan-2-ylpiperazin-1-yl)benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060832 |
| Molecular Formula | C25H29ClF3N3O5 |
| Molecular Weight | 543.97 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | 5-[(3-chlorobenzoyl)amino]-2-(4-pentan-2-ylpiperazin-1-yl)benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCC(C)N1CCN(c2ccc(NC(=O)c3cccc(Cl)c3)cc2C(=O)O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H28ClN3O3.C2HF3O2/c1-3-5-16(2)26-10-12-27(13-11-26)21-9-8-19(15-20(21)23(29)30)25-22(28)17-6-4-7-18(24)14-17;3-2(4,5)1(6)7/h4,6-9,14-16H,3,5,10-13H2,1-2H3,(H,25,28)(H,29,30);(H,6,7) |
| InChIKey | CJUVZWIQFFMAIG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.97 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|