About pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate
pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate (PubChem CID 130220938) has the molecular formula C25H23N5O2
and a molecular weight of 425.49 g/mol. Its IUPAC name is pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate.
Molecular Properties
| Compound Name | pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate |
| PubChem CID | 130220938 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate |
| SMILES | Cc1cc(N2CCC(c3ccccc3)C2)c2cc(NC(=O)Oc3cnccn3)ccc2n1 |
| InChI | InChI=1S/C25H23N5O2/c1-17-13-23(30-12-9-19(16-30)18-5-3-2-4-6-18)21-14-20(7-8-22(21)28-17)29-25(31)32-24-15-26-10-11-27-24/h2-8,10-11,13-15,19H,9,12,16H2,1H3,(H,29,31) |
| InChIKey | IQXKTBMBIFYXRZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate?
The IUPAC name of pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate (CID 130220938) is pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate.
What is the SMILES notation for pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate?
The canonical SMILES for pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate is Cc1cc(N2CCC(c3ccccc3)C2)c2cc(NC(=O)Oc3cnccn3)ccc2n1.
What is the InChIKey of pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate?
The InChIKey is IQXKTBMBIFYXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N5O2/c1-17-13-23(30-12-9-19(16-30)18-5-3-2-4-6-18)21-14-20(7-8-22(21)28-17)29-25(31)32-24-15-26-10-11-27-24/h2-8,10-11,13-15,19H,9,12,16H2,1H3,(H,29,31).
What are the key properties of pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate?
pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate has a molecular weight of 425.49 g/mol, XLogP of 4.94, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazin-2-yl N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]carbamate is sourced from PubChem (CID 130220938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).