C26H26ClN3O2S — CID 68776069
N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]benzenesulfonamide;hydrochloride (PubChem CID 68776069) has the molecular formula C26H26ClN3O2S and a molecular weight of 480.03 g/mol. Its IUPAC name is N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 68776069 |
| Molecular Formula | C26H26ClN3O2S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | N-[2-methyl-4-(3-phenylpyrrolidin-1-yl)quinolin-6-yl]benzenesulfonamide;hydrochloride |
| SMILES | Cc1cc(N2CCC(c3ccccc3)C2)c2cc(NS(=O)(=O)c3ccccc3)ccc2n1.Cl |
| InChI | InChI=1S/C26H25N3O2S.ClH/c1-19-16-26(29-15-14-21(18-29)20-8-4-2-5-9-20)24-17-22(12-13-25(24)27-19)28-32(30,31)23-10-6-3-7-11-23;/h2-13,16-17,21,28H,14-15,18H2,1H3;1H |
| InChIKey | NTACJKKBOZQUFG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |