C25H22N4O — CID 135300433
(2-phenyl-3-pyridin-4-ylquinoxalin-6-yl)-piperidin-1-ylmethanone (PubChem CID 135300433) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is (2-phenyl-3-pyridin-4-ylquinoxalin-6-yl)-piperidin-1-ylmethanone.
| Compound Name | (2-phenyl-3-pyridin-4-ylquinoxalin-6-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 135300433 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (2-phenyl-3-pyridin-4-ylquinoxalin-6-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc2nc(-c3ccccc3)c(-c3ccncc3)nc2c1)N1CCCCC1 |
| InChI | InChI=1S/C25H22N4O/c30-25(29-15-5-2-6-16-29)20-9-10-21-22(17-20)28-24(19-11-13-26-14-12-19)23(27-21)18-7-3-1-4-8-18/h1,3-4,7-14,17H,2,5-6,15-16H2 |
| InChIKey | ZQRNLBGHJFNDLS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |