C25H27N3O3 — CID 57410871
5-[3-phenyl-7-(piperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid (PubChem CID 57410871) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 5-[3-phenyl-7-(piperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[3-phenyl-7-(piperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 57410871 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 5-[3-phenyl-7-(piperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2cc(C(=O)N3CCCCC3)ccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C25H27N3O3/c29-23(30)12-6-5-11-21-24(18-9-3-1-4-10-18)27-20-14-13-19(17-22(20)26-21)25(31)28-15-7-2-8-16-28/h1,3-4,9-10,13-14,17H,2,5-8,11-12,15-16H2,(H,29,30) |
| InChIKey | KHLZAFFKSHZTBQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|