C30H35ClN4O2 — CID 129209899
5-[3-(4-chlorophenyl)-7-[1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethenyl]quinoxalin-2-yl]pentanoic acid (PubChem CID 129209899) has the molecular formula C30H35ClN4O2 and a molecular weight of 519.09 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)-7-[1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethenyl]quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[3-(4-chlorophenyl)-7-[1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethenyl]quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 129209899 |
| Molecular Formula | C30H35ClN4O2 |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 5-[3-(4-chlorophenyl)-7-[1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethenyl]quinoxalin-2-yl]pentanoic acid |
| SMILES | C=C(c1ccc2nc(-c3ccc(Cl)cc3)c(CCCCC(=O)O)nc2c1)N1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C30H35ClN4O2/c1-21(34-18-14-25(15-19-34)35-16-4-5-17-35)23-10-13-26-28(20-23)32-27(6-2-3-7-29(36)37)30(33-26)22-8-11-24(31)12-9-22/h8-13,20,25H,1-7,14-19H2,(H,36,37) |
| InChIKey | PMOKJWZSKJWMGA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|