C30H28ClN3O3 — CID 77452115
5-[7-[(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid (PubChem CID 77452115) has the molecular formula C30H28ClN3O3 and a molecular weight of 514.03 g/mol. Its IUPAC name is 5-[7-[(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[7-[(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 77452115 |
| Molecular Formula | C30H28ClN3O3 |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 5-[7-[(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2cc(C(=O)NC3CCCc4cc(Cl)ccc43)ccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C30H28ClN3O3/c31-22-14-15-23-20(17-22)9-6-11-24(23)34-30(37)21-13-16-25-27(18-21)32-26(10-4-5-12-28(35)36)29(33-25)19-7-2-1-3-8-19/h1-3,7-8,13-18,24H,4-6,9-12H2,(H,34,37)(H,35,36) |
| InChIKey | PTIMNAOMDHTSPB-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|