C29H26N2O4 — CID 57410300
5-[6-[[(3R)-2,3-dihydro-1-benzofuran-3-yl]carbamoyl]-2-phenylquinolin-3-yl]pentanoic acid (PubChem CID 57410300) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 5-[6-[[(3R)-2,3-dihydro-1-benzofuran-3-yl]carbamoyl]-2-phenylquinolin-3-yl]pentanoic acid.
| Compound Name | 5-[6-[[(3R)-2,3-dihydro-1-benzofuran-3-yl]carbamoyl]-2-phenylquinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 57410300 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 5-[6-[[(3R)-2,3-dihydro-1-benzofuran-3-yl]carbamoyl]-2-phenylquinolin-3-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1cc2cc(C(=O)N[C@H]3COc4ccccc43)ccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C29H26N2O4/c32-27(33)13-7-4-10-20-16-22-17-21(14-15-24(22)30-28(20)19-8-2-1-3-9-19)29(34)31-25-18-35-26-12-6-5-11-23(25)26/h1-3,5-6,8-9,11-12,14-17,25H,4,7,10,13,18H2,(H,31,34)(H,32,33)/t25-/m0/s1 |
| InChIKey | XRNSZVQSIIZFCK-VWLOTQADSA-N |
| XLogP | 5.56 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|