C30H31N3O3 — CID 126659264
5-[6-[[(1R)-3-[(Z)-3-iminoprop-1-enyl]-2-methylcyclopent-2-en-1-yl]carbamoyl]-2-phenylquinolin-3-yl]pentanoic acid (PubChem CID 126659264) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 5-[6-[[(1R)-3-[(Z)-3-iminoprop-1-enyl]-2-methylcyclopent-2-en-1-yl]carbamoyl]-2-phenylquinolin-3-yl]pentanoic acid.
| Compound Name | 5-[6-[[(1R)-3-[(Z)-3-iminoprop-1-enyl]-2-methylcyclopent-2-en-1-yl]carbamoyl]-2-phenylquinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 126659264 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 5-[6-[[(1R)-3-[(Z)-3-iminoprop-1-enyl]-2-methylcyclopent-2-en-1-yl]carbamoyl]-2-phenylquinolin-3-yl]pentanoic acid |
| SMILES | [H]/N=C/C=C\C1=C(C)[C@H](NC(=O)c2ccc3nc(-c4ccccc4)c(CCCCC(=O)O)cc3c2)CC1 |
| InChI | InChI=1S/C30H31N3O3/c1-20-21(11-7-17-31)13-15-26(20)33-30(36)24-14-16-27-25(19-24)18-23(10-5-6-12-28(34)35)29(32-27)22-8-3-2-4-9-22/h2-4,7-9,11,14,16-19,26,31H,5-6,10,12-13,15H2,1H3,(H,33,36)(H,34,35)/b11-7-,31-17+/t26-/m1/s1 |
| InChIKey | LCRMBUDWMVTVRF-BBWWPDPISA-N |
| XLogP | 6.11 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|