C29H28N2O3 — CID 57411737
5-[6-[(4-methylphenyl)methylcarbamoyl]-2-phenylquinolin-3-yl]pentanoic acid (PubChem CID 57411737) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is 5-[6-[(4-methylphenyl)methylcarbamoyl]-2-phenylquinolin-3-yl]pentanoic acid.
| Compound Name | 5-[6-[(4-methylphenyl)methylcarbamoyl]-2-phenylquinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 57411737 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 5-[6-[(4-methylphenyl)methylcarbamoyl]-2-phenylquinolin-3-yl]pentanoic acid |
| SMILES | Cc1ccc(CNC(=O)c2ccc3nc(-c4ccccc4)c(CCCCC(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C29H28N2O3/c1-20-11-13-21(14-12-20)19-30-29(34)24-15-16-26-25(18-24)17-23(9-5-6-10-27(32)33)28(31-26)22-7-3-2-4-8-22/h2-4,7-8,11-18H,5-6,9-10,19H2,1H3,(H,30,34)(H,32,33) |
| InChIKey | IOCJGFRPYJTAJR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|