C27H24FN3O3 — CID 57410158
5-[7-(benzylcarbamoyl)-3-(4-fluorophenyl)quinoxalin-2-yl]pentanoic acid (PubChem CID 57410158) has the molecular formula C27H24FN3O3 and a molecular weight of 457.51 g/mol. Its IUPAC name is 5-[7-(benzylcarbamoyl)-3-(4-fluorophenyl)quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[7-(benzylcarbamoyl)-3-(4-fluorophenyl)quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 57410158 |
| Molecular Formula | C27H24FN3O3 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 5-[7-(benzylcarbamoyl)-3-(4-fluorophenyl)quinoxalin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2cc(C(=O)NCc3ccccc3)ccc2nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H24FN3O3/c28-21-13-10-19(11-14-21)26-23(8-4-5-9-25(32)33)30-24-16-20(12-15-22(24)31-26)27(34)29-17-18-6-2-1-3-7-18/h1-3,6-7,10-16H,4-5,8-9,17H2,(H,29,34)(H,32,33) |
| InChIKey | ULBQWOQDFKIDJN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|