C29H29N3O3 — CID 57410625
5-[7-[(4-ethylphenyl)methylcarbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid (PubChem CID 57410625) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 5-[7-[(4-ethylphenyl)methylcarbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[7-[(4-ethylphenyl)methylcarbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 57410625 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 5-[7-[(4-ethylphenyl)methylcarbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
| SMILES | CCc1ccc(CNC(=O)c2ccc3nc(-c4ccccc4)c(CCCCC(=O)O)nc3c2)cc1 |
| InChI | InChI=1S/C29H29N3O3/c1-2-20-12-14-21(15-13-20)19-30-29(35)23-16-17-24-26(18-23)31-25(10-6-7-11-27(33)34)28(32-24)22-8-4-3-5-9-22/h3-5,8-9,12-18H,2,6-7,10-11,19H2,1H3,(H,30,35)(H,33,34) |
| InChIKey | QGRPUHUSFNWTSJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|