C27H25IN4O3 — CID 129209708
5-[7-[[4-(iodomethyl)phenyl]methylcarbamoyl]-3-phenylpyrido[2,3-b]pyrazin-2-yl]pentanoic acid (PubChem CID 129209708) has the molecular formula C27H25IN4O3 and a molecular weight of 580.43 g/mol. Its IUPAC name is 5-[7-[[4-(iodomethyl)phenyl]methylcarbamoyl]-3-phenylpyrido[2,3-b]pyrazin-2-yl]pentanoic acid.
| Compound Name | 5-[7-[[4-(iodomethyl)phenyl]methylcarbamoyl]-3-phenylpyrido[2,3-b]pyrazin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 129209708 |
| Molecular Formula | C27H25IN4O3 |
| Molecular Weight | 580.43 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | 5-[7-[[4-(iodomethyl)phenyl]methylcarbamoyl]-3-phenylpyrido[2,3-b]pyrazin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2cc(C(=O)NCc3ccc(CI)cc3)cnc2nc1-c1ccccc1 |
| InChI | InChI=1S/C27H25IN4O3/c28-15-18-10-12-19(13-11-18)16-30-27(35)21-14-23-26(29-17-21)32-25(20-6-2-1-3-7-20)22(31-23)8-4-5-9-24(33)34/h1-3,6-7,10-14,17H,4-5,8-9,15-16H2,(H,30,35)(H,33,34) |
| InChIKey | XQYKXGYWHRPLPW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|