C28H23FN4O3 — CID 57411817
5-[7-[(4-cyanophenyl)methylcarbamoyl]-3-(4-fluorophenyl)quinoxalin-2-yl]pentanoic acid (PubChem CID 57411817) has the molecular formula C28H23FN4O3 and a molecular weight of 482.52 g/mol. Its IUPAC name is 5-[7-[(4-cyanophenyl)methylcarbamoyl]-3-(4-fluorophenyl)quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[7-[(4-cyanophenyl)methylcarbamoyl]-3-(4-fluorophenyl)quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 57411817 |
| Molecular Formula | C28H23FN4O3 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 5-[7-[(4-cyanophenyl)methylcarbamoyl]-3-(4-fluorophenyl)quinoxalin-2-yl]pentanoic acid |
| SMILES | N#Cc1ccc(CNC(=O)c2ccc3nc(-c4ccc(F)cc4)c(CCCCC(=O)O)nc3c2)cc1 |
| InChI | InChI=1S/C28H23FN4O3/c29-22-12-9-20(10-13-22)27-24(3-1-2-4-26(34)35)32-25-15-21(11-14-23(25)33-27)28(36)31-17-19-7-5-18(16-30)6-8-19/h5-15H,1-4,17H2,(H,31,36)(H,34,35) |
| InChIKey | IPNZPRIFDFNGBG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|