C30H25F4N3O2 — CID 126640576
5-[6-[[[(1R)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]amino]methyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid (PubChem CID 126640576) has the molecular formula C30H25F4N3O2 and a molecular weight of 535.54 g/mol. Its IUPAC name is 5-[6-[[[(1R)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]amino]methyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid.
| Compound Name | 5-[6-[[[(1R)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]amino]methyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 126640576 |
| Molecular Formula | C30H25F4N3O2 |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 5-[6-[[[(1R)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]amino]methyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid |
| SMILES | N#Cc1ccc([C@@H](NCc2ccc3nc(-c4ccc(F)cc4)c(CCCCC(=O)O)cc3c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H25F4N3O2/c31-25-12-10-21(11-13-25)28-23(3-1-2-4-27(38)39)16-24-15-20(7-14-26(24)37-28)18-36-29(30(32,33)34)22-8-5-19(17-35)6-9-22/h5-16,29,36H,1-4,18H2,(H,38,39)/t29-/m1/s1 |
| InChIKey | OUIBRLSRKJYPCS-GDLZYMKVSA-N |
| XLogP | 7.10 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|