C30H28FN3O3 — CID 126659186
2-(4-fluorophenyl)-N-[(1S)-1-(4-methylphenyl)ethyl]-3-(5-nitroso-5-oxopentyl)quinoline-6-carboxamide (PubChem CID 126659186) has the molecular formula C30H28FN3O3 and a molecular weight of 497.57 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(1S)-1-(4-methylphenyl)ethyl]-3-(5-nitroso-5-oxopentyl)quinoline-6-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(1S)-1-(4-methylphenyl)ethyl]-3-(5-nitroso-5-oxopentyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 126659186 |
| Molecular Formula | C30H28FN3O3 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(1S)-1-(4-methylphenyl)ethyl]-3-(5-nitroso-5-oxopentyl)quinoline-6-carboxamide |
| SMILES | Cc1ccc([C@H](C)NC(=O)c2ccc3nc(-c4ccc(F)cc4)c(CCCCC(=O)N=O)cc3c2)cc1 |
| InChI | InChI=1S/C30H28FN3O3/c1-19-7-9-21(10-8-19)20(2)32-30(36)24-13-16-27-25(18-24)17-23(5-3-4-6-28(35)34-37)29(33-27)22-11-14-26(31)15-12-22/h7-18,20H,3-6H2,1-2H3,(H,32,36)/t20-/m0/s1 |
| InChIKey | JTFVEXNBKCNAJR-FQEVSTJZSA-N |
| XLogP | 6.85 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|