C31H34ClFN2O3 — CID 126659188
5-[6-[[(1R)-1-(3-chloro-5-methylphenyl)ethyl]carbamoyl]-2-[(2E,4Z)-6-fluorohepta-2,4-dien-3-yl]quinolin-3-yl]pentanoic acid (PubChem CID 126659188) has the molecular formula C31H34ClFN2O3 and a molecular weight of 537.08 g/mol. Its IUPAC name is 5-[6-[[(1R)-1-(3-chloro-5-methylphenyl)ethyl]carbamoyl]-2-[(2E,4Z)-6-fluorohepta-2,4-dien-3-yl]quinolin-3-yl]pentanoic acid.
| Compound Name | 5-[6-[[(1R)-1-(3-chloro-5-methylphenyl)ethyl]carbamoyl]-2-[(2E,4Z)-6-fluorohepta-2,4-dien-3-yl]quinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 126659188 |
| Molecular Formula | C31H34ClFN2O3 |
| Molecular Weight | 537.08 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 5-[6-[[(1R)-1-(3-chloro-5-methylphenyl)ethyl]carbamoyl]-2-[(2E,4Z)-6-fluorohepta-2,4-dien-3-yl]quinolin-3-yl]pentanoic acid |
| SMILES | C/C=C(\C=C/C(C)F)c1nc2ccc(C(=O)N[C@H](C)c3cc(C)cc(Cl)c3)cc2cc1CCCCC(=O)O |
| InChI | InChI=1S/C31H34ClFN2O3/c1-5-22(11-10-20(3)33)30-23(8-6-7-9-29(36)37)16-26-17-24(12-13-28(26)35-30)31(38)34-21(4)25-14-19(2)15-27(32)18-25/h5,10-18,20-21H,6-9H2,1-4H3,(H,34,38)(H,36,37)/b11-10-,22-5+/t20?,21-/m1/s1 |
| InChIKey | KTMHFNPOYYGKGF-RZJBWTQTSA-N |
| XLogP | 7.80 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.08 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|