C31H31ClN4O3 — CID 57411270
5-[2-(4-chlorophenyl)-6-[(4-phenylpiperazin-1-yl)carbamoyl]quinolin-3-yl]pentanoic acid (PubChem CID 57411270) has the molecular formula C31H31ClN4O3 and a molecular weight of 543.07 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)-6-[(4-phenylpiperazin-1-yl)carbamoyl]quinolin-3-yl]pentanoic acid.
| Compound Name | 5-[2-(4-chlorophenyl)-6-[(4-phenylpiperazin-1-yl)carbamoyl]quinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 57411270 |
| Molecular Formula | C31H31ClN4O3 |
| Molecular Weight | 543.07 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 5-[2-(4-chlorophenyl)-6-[(4-phenylpiperazin-1-yl)carbamoyl]quinolin-3-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1cc2cc(C(=O)NN3CCN(c4ccccc4)CC3)ccc2nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H31ClN4O3/c32-26-13-10-22(11-14-26)30-23(6-4-5-9-29(37)38)20-25-21-24(12-15-28(25)33-30)31(39)34-36-18-16-35(17-19-36)27-7-2-1-3-8-27/h1-3,7-8,10-15,20-21H,4-6,9,16-19H2,(H,34,39)(H,37,38) |
| InChIKey | NRGUPRMKRZPKEJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.07 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|