C30H27ClN2O4 — CID 67982004
5-[2-(4-chlorophenyl)-6-(3,4-dihydro-2H-chromen-4-ylcarbamoyl)quinolin-3-yl]pentanoic acid (PubChem CID 67982004) has the molecular formula C30H27ClN2O4 and a molecular weight of 515.01 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)-6-(3,4-dihydro-2H-chromen-4-ylcarbamoyl)quinolin-3-yl]pentanoic acid.
| Compound Name | 5-[2-(4-chlorophenyl)-6-(3,4-dihydro-2H-chromen-4-ylcarbamoyl)quinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 67982004 |
| Molecular Formula | C30H27ClN2O4 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 5-[2-(4-chlorophenyl)-6-(3,4-dihydro-2H-chromen-4-ylcarbamoyl)quinolin-3-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1cc2cc(C(=O)NC3CCOc4ccccc43)ccc2nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H27ClN2O4/c31-23-12-9-19(10-13-23)29-20(5-1-4-8-28(34)35)17-22-18-21(11-14-25(22)32-29)30(36)33-26-15-16-37-27-7-3-2-6-24(26)27/h2-3,6-7,9-14,17-18,26H,1,4-5,8,15-16H2,(H,33,36)(H,34,35) |
| InChIKey | WPUVXDQAIRRLBX-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|