C30H27ClN2O3 — CID 57411508
5-[2-(4-chlorophenyl)-6-(3-phenylazetidine-1-carbonyl)quinolin-3-yl]pentanoic acid (PubChem CID 57411508) has the molecular formula C30H27ClN2O3 and a molecular weight of 499.01 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)-6-(3-phenylazetidine-1-carbonyl)quinolin-3-yl]pentanoic acid.
| Compound Name | 5-[2-(4-chlorophenyl)-6-(3-phenylazetidine-1-carbonyl)quinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 57411508 |
| Molecular Formula | C30H27ClN2O3 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 5-[2-(4-chlorophenyl)-6-(3-phenylazetidine-1-carbonyl)quinolin-3-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1cc2cc(C(=O)N3CC(c4ccccc4)C3)ccc2nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H27ClN2O3/c31-26-13-10-21(11-14-26)29-22(8-4-5-9-28(34)35)16-24-17-23(12-15-27(24)32-29)30(36)33-18-25(19-33)20-6-2-1-3-7-20/h1-3,6-7,10-17,25H,4-5,8-9,18-19H2,(H,34,35) |
| InChIKey | PQWDHFXHDKVAHU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|