C32H32N2O3 — CID 57411738
5-[2-phenyl-6-[(3R)-3-phenylpiperidine-1-carbonyl]quinolin-3-yl]pentanoic acid (PubChem CID 57411738) has the molecular formula C32H32N2O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is 5-[2-phenyl-6-[(3R)-3-phenylpiperidine-1-carbonyl]quinolin-3-yl]pentanoic acid.
| Compound Name | 5-[2-phenyl-6-[(3R)-3-phenylpiperidine-1-carbonyl]quinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 57411738 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 5-[2-phenyl-6-[(3R)-3-phenylpiperidine-1-carbonyl]quinolin-3-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1cc2cc(C(=O)N3CCC[C@H](c4ccccc4)C3)ccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C32H32N2O3/c35-30(36)16-8-7-14-25-20-28-21-26(17-18-29(28)33-31(25)24-12-5-2-6-13-24)32(37)34-19-9-15-27(22-34)23-10-3-1-4-11-23/h1-6,10-13,17-18,20-21,27H,7-9,14-16,19,22H2,(H,35,36)/t27-/m0/s1 |
| InChIKey | BDYNFBDTOUUICZ-MHZLTWQESA-N |
| XLogP | 6.72 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|