C29H30N2O2 — CID 126640572
5-[2-phenyl-6-[[[(1R)-1-phenylethyl]amino]methyl]quinolin-3-yl]pentanoic acid (PubChem CID 126640572) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 5-[2-phenyl-6-[[[(1R)-1-phenylethyl]amino]methyl]quinolin-3-yl]pentanoic acid.
| Compound Name | 5-[2-phenyl-6-[[[(1R)-1-phenylethyl]amino]methyl]quinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 126640572 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-[2-phenyl-6-[[[(1R)-1-phenylethyl]amino]methyl]quinolin-3-yl]pentanoic acid |
| SMILES | C[C@@H](NCc1ccc2nc(-c3ccccc3)c(CCCCC(=O)O)cc2c1)c1ccccc1 |
| InChI | InChI=1S/C29H30N2O2/c1-21(23-10-4-2-5-11-23)30-20-22-16-17-27-26(18-22)19-25(14-8-9-15-28(32)33)29(31-27)24-12-6-3-7-13-24/h2-7,10-13,16-19,21,30H,8-9,14-15,20H2,1H3,(H,32,33)/t21-/m1/s1 |
| InChIKey | VVDVGMCJXCWANC-OAQYLSRUSA-N |
| XLogP | 6.55 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|