C28H27N3O3 — CID 57410037
5-[3-phenyl-7-[[(1S)-1-phenylethyl]carbamoyl]quinoxalin-2-yl]pentanoic acid (PubChem CID 57410037) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 5-[3-phenyl-7-[[(1S)-1-phenylethyl]carbamoyl]quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[3-phenyl-7-[[(1S)-1-phenylethyl]carbamoyl]quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 57410037 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 5-[3-phenyl-7-[[(1S)-1-phenylethyl]carbamoyl]quinoxalin-2-yl]pentanoic acid |
| SMILES | C[C@H](NC(=O)c1ccc2nc(-c3ccccc3)c(CCCCC(=O)O)nc2c1)c1ccccc1 |
| InChI | InChI=1S/C28H27N3O3/c1-19(20-10-4-2-5-11-20)29-28(34)22-16-17-23-25(18-22)30-24(14-8-9-15-26(32)33)27(31-23)21-12-6-3-7-13-21/h2-7,10-13,16-19H,8-9,14-15H2,1H3,(H,29,34)(H,32,33)/t19-/m0/s1 |
| InChIKey | IWQFMQWAUOIELK-IBGZPJMESA-N |
| XLogP | 5.59 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|