C26H25N5O3 — CID 129210465
5-[7-[amino(pyridin-2-ylmethyl)carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid (PubChem CID 129210465) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is 5-[7-[amino(pyridin-2-ylmethyl)carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[7-[amino(pyridin-2-ylmethyl)carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 129210465 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 5-[7-[amino(pyridin-2-ylmethyl)carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
| SMILES | NN(Cc1ccccn1)C(=O)c1ccc2nc(-c3ccccc3)c(CCCCC(=O)O)nc2c1 |
| InChI | InChI=1S/C26H25N5O3/c27-31(17-20-10-6-7-15-28-20)26(34)19-13-14-21-23(16-19)29-22(11-4-5-12-24(32)33)25(30-21)18-8-2-1-3-9-18/h1-3,6-10,13-16H,4-5,11-12,17,27H2,(H,32,33) |
| InChIKey | MMVYBFMHJXTVJW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|