C29H27FN2O3 — CID 162230449
5-[6-[(3S)-3-(4-fluorophenyl)butanoyl]-3-phenylquinoxalin-2-yl]pentanoic acid (PubChem CID 162230449) has the molecular formula C29H27FN2O3 and a molecular weight of 470.54 g/mol. Its IUPAC name is 5-[6-[(3S)-3-(4-fluorophenyl)butanoyl]-3-phenylquinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[6-[(3S)-3-(4-fluorophenyl)butanoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 162230449 |
| Molecular Formula | C29H27FN2O3 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 5-[6-[(3S)-3-(4-fluorophenyl)butanoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
| SMILES | C[C@@H](CC(=O)c1ccc2nc(CCCCC(=O)O)c(-c3ccccc3)nc2c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H27FN2O3/c1-19(20-11-14-23(30)15-12-20)17-27(33)22-13-16-24-26(18-22)32-29(21-7-3-2-4-8-21)25(31-24)9-5-6-10-28(34)35/h2-4,7-8,11-16,18-19H,5-6,9-10,17H2,1H3,(H,34,35)/t19-/m0/s1 |
| InChIKey | ZVIROKBYGAITAN-IBGZPJMESA-N |
| XLogP | 6.61 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|