C26H23ClN4O3 — CID 57411001
5-[7-[(6-chloro-2-pyridinyl)methylcarbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid (PubChem CID 57411001) has the molecular formula C26H23ClN4O3 and a molecular weight of 474.95 g/mol. Its IUPAC name is 5-[7-[(6-chloro-2-pyridinyl)methylcarbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[7-[(6-chloro-2-pyridinyl)methylcarbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 57411001 |
| Molecular Formula | C26H23ClN4O3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 5-[7-[(6-chloro-2-pyridinyl)methylcarbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2cc(C(=O)NCc3cccc(Cl)n3)ccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C26H23ClN4O3/c27-23-11-6-9-19(29-23)16-28-26(34)18-13-14-20-22(15-18)30-21(10-4-5-12-24(32)33)25(31-20)17-7-2-1-3-8-17/h1-3,6-9,11,13-15H,4-5,10,12,16H2,(H,28,34)(H,32,33) |
| InChIKey | DFMDDIZIKNIOPL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|