C29H24FN3O3 — CID 126659358
5-[6-[(4-cyanophenyl)methylcarbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid (PubChem CID 126659358) has the molecular formula C29H24FN3O3 and a molecular weight of 481.53 g/mol. Its IUPAC name is 5-[6-[(4-cyanophenyl)methylcarbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid.
| Compound Name | 5-[6-[(4-cyanophenyl)methylcarbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 126659358 |
| Molecular Formula | C29H24FN3O3 |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 5-[6-[(4-cyanophenyl)methylcarbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid |
| SMILES | N#Cc1ccc(CNC(=O)c2ccc3nc(-c4ccc(F)cc4)c(CCCCC(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C29H24FN3O3/c30-25-12-9-21(10-13-25)28-22(3-1-2-4-27(34)35)15-24-16-23(11-14-26(24)33-28)29(36)32-18-20-7-5-19(17-31)6-8-20/h5-16H,1-4,18H2,(H,32,36)(H,34,35) |
| InChIKey | FCASMIDXJMRTMG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|