C29H26FN3O2 — CID 163442613
N-[(1R)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-oxobutyl)-2-phenylquinoxaline-6-carboxamide (PubChem CID 163442613) has the molecular formula C29H26FN3O2 and a molecular weight of 467.54 g/mol. Its IUPAC name is N-[(1R)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-oxobutyl)-2-phenylquinoxaline-6-carboxamide.
| Compound Name | N-[(1R)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-oxobutyl)-2-phenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 163442613 |
| Molecular Formula | C29H26FN3O2 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[(1R)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(4-oxobutyl)-2-phenylquinoxaline-6-carboxamide |
| SMILES | O=CCCCc1nc2cc(C(=O)N[C@@H]3CCCc4cc(F)ccc43)ccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C29H26FN3O2/c30-22-13-14-23-20(17-22)9-6-11-24(23)33-29(35)21-12-15-25-27(18-21)31-26(10-4-5-16-34)28(32-25)19-7-2-1-3-8-19/h1-3,7-8,12-18,24H,4-6,9-11H2,(H,33,35)/t24-/m1/s1 |
| InChIKey | AZULUBJERXHHHO-XMMPIXPASA-N |
| XLogP | 5.76 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|