C34H33F2N3O3S — CID 123186471
3-[5-(cyclopropylsulfanylamino)-5-oxopentyl]-2-(4-fluorophenyl)-N-(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-1-oxoisoquinoline-6-carboxamide (PubChem CID 123186471) has the molecular formula C34H33F2N3O3S and a molecular weight of 601.72 g/mol. Its IUPAC name is 3-[5-(cyclopropylsulfanylamino)-5-oxopentyl]-2-(4-fluorophenyl)-N-(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-1-oxoisoquinoline-6-carboxamide.
| Compound Name | 3-[5-(cyclopropylsulfanylamino)-5-oxopentyl]-2-(4-fluorophenyl)-N-(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-1-oxoisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 123186471 |
| Molecular Formula | C34H33F2N3O3S |
| Molecular Weight | 601.72 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | 3-[5-(cyclopropylsulfanylamino)-5-oxopentyl]-2-(4-fluorophenyl)-N-(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-1-oxoisoquinoline-6-carboxamide |
| SMILES | O=C(CCCCc1cc2cc(C(=O)NC3CCCc4cc(F)ccc43)ccc2c(=O)n1-c1ccc(F)cc1)NSC1CC1 |
| InChI | InChI=1S/C34H33F2N3O3S/c35-24-9-12-26(13-10-24)39-27(5-1-2-7-32(40)38-43-28-14-15-28)20-23-18-22(8-16-30(23)34(39)42)33(41)37-31-6-3-4-21-19-25(36)11-17-29(21)31/h8-13,16-20,28,31H,1-7,14-15H2,(H,37,41)(H,38,40) |
| InChIKey | XEVONGUVBROJLJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.72 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|