C29H24Cl2N4O3 — CID 129209881
N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(4-chlorophenyl)-3-(5-nitroso-5-oxopentyl)quinoxaline-6-carboxamide (PubChem CID 129209881) has the molecular formula C29H24Cl2N4O3 and a molecular weight of 547.44 g/mol. Its IUPAC name is N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(4-chlorophenyl)-3-(5-nitroso-5-oxopentyl)quinoxaline-6-carboxamide.
| Compound Name | N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(4-chlorophenyl)-3-(5-nitroso-5-oxopentyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 129209881 |
| Molecular Formula | C29H24Cl2N4O3 |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-(4-chlorophenyl)-3-(5-nitroso-5-oxopentyl)quinoxaline-6-carboxamide |
| SMILES | O=NC(=O)CCCCc1nc2cc(C(=O)N[C@@H]3CCc4cc(Cl)ccc43)ccc2nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H24Cl2N4O3/c30-20-9-5-17(6-10-20)28-25(3-1-2-4-27(36)35-38)32-26-16-19(8-14-24(26)33-28)29(37)34-23-13-7-18-15-21(31)11-12-22(18)23/h5-6,8-12,14-16,23H,1-4,7,13H2,(H,34,37)/t23-/m1/s1 |
| InChIKey | WLFQBPCVFPMVQY-HSZRJFAPSA-N |
| XLogP | 7.03 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|