C33H35N3O4 — CID 129210524
5-[3-(2-acetylphenyl)-7-(4-cyclohexa-1,5-dien-1-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid (PubChem CID 129210524) has the molecular formula C33H35N3O4 and a molecular weight of 537.66 g/mol. Its IUPAC name is 5-[3-(2-acetylphenyl)-7-(4-cyclohexa-1,5-dien-1-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[3-(2-acetylphenyl)-7-(4-cyclohexa-1,5-dien-1-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 129210524 |
| Molecular Formula | C33H35N3O4 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 5-[3-(2-acetylphenyl)-7-(4-cyclohexa-1,5-dien-1-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid |
| SMILES | CC(=O)c1ccccc1-c1nc2ccc(C(=O)N3CCC(C4=CCCC=C4)CC3)cc2nc1CCCCC(=O)O |
| InChI | InChI=1S/C33H35N3O4/c1-22(37)26-11-5-6-12-27(26)32-29(13-7-8-14-31(38)39)34-30-21-25(15-16-28(30)35-32)33(40)36-19-17-24(18-20-36)23-9-3-2-4-10-23/h3,5-6,9-12,15-16,21,24H,2,4,7-8,13-14,17-20H2,1H3,(H,38,39) |
| InChIKey | PRNFAWVCWWNFNI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|