C30H33N5O3 — CID 129210485
5-[3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-(4-pyrazin-2-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid (PubChem CID 129210485) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is 5-[3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-(4-pyrazin-2-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-(4-pyrazin-2-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 129210485 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 5-[3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-(4-pyrazin-2-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid |
| SMILES | C=C(/C=C\C=C/C)c1nc2ccc(C(=O)N3CCC(c4cnccn4)CC3)cc2nc1CCCCC(=O)O |
| InChI | InChI=1S/C30H33N5O3/c1-3-4-5-8-21(2)29-25(9-6-7-10-28(36)37)33-26-19-23(11-12-24(26)34-29)30(38)35-17-13-22(14-18-35)27-20-31-15-16-32-27/h3-5,8,11-12,15-16,19-20,22H,2,6-7,9-10,13-14,17-18H2,1H3,(H,36,37)/b4-3-,8-5- |
| InChIKey | LAFNTHNKNVUYOC-UBNNFMAXSA-N |
| XLogP | 5.38 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|