C21H23ClN2O3 — CID 129210284
5-[3-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-7-(hydroxymethyl)quinoxalin-2-yl]pentanoic acid (PubChem CID 129210284) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is 5-[3-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-7-(hydroxymethyl)quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[3-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-7-(hydroxymethyl)quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 129210284 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5-[3-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-7-(hydroxymethyl)quinoxalin-2-yl]pentanoic acid |
| SMILES | C=C(/C=C\C(Cl)=C/C)c1nc2ccc(CO)cc2nc1CCCCC(=O)O |
| InChI | InChI=1S/C21H23ClN2O3/c1-3-16(22)10-8-14(2)21-18(6-4-5-7-20(26)27)23-19-12-15(13-25)9-11-17(19)24-21/h3,8-12,25H,2,4-7,13H2,1H3,(H,26,27)/b10-8-,16-3+ |
| InChIKey | QSHRXCFZDJTNGO-GGHDZXMESA-N |
| XLogP | 4.63 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|