C34H37ClN4O3 — CID 123239136
5-[3-(4-chlorophenyl)-7-[2-methoxy-2-[3-(methyliminomethyl)-3-phenylpyrrolidin-1-yl]ethyl]quinoxalin-2-yl]pentanoic acid (PubChem CID 123239136) has the molecular formula C34H37ClN4O3 and a molecular weight of 585.15 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)-7-[2-methoxy-2-[3-(methyliminomethyl)-3-phenylpyrrolidin-1-yl]ethyl]quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[3-(4-chlorophenyl)-7-[2-methoxy-2-[3-(methyliminomethyl)-3-phenylpyrrolidin-1-yl]ethyl]quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 123239136 |
| Molecular Formula | C34H37ClN4O3 |
| Molecular Weight | 585.15 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 5-[3-(4-chlorophenyl)-7-[2-methoxy-2-[3-(methyliminomethyl)-3-phenylpyrrolidin-1-yl]ethyl]quinoxalin-2-yl]pentanoic acid |
| SMILES | C/N=C/C1(c2ccccc2)CCN(C(Cc2ccc3nc(-c4ccc(Cl)cc4)c(CCCCC(=O)O)nc3c2)OC)C1 |
| InChI | InChI=1S/C34H37ClN4O3/c1-36-22-34(26-8-4-3-5-9-26)18-19-39(23-34)31(42-2)21-24-12-17-28-30(20-24)37-29(10-6-7-11-32(40)41)33(38-28)25-13-15-27(35)16-14-25/h3-5,8-9,12-17,20,22,31H,6-7,10-11,18-19,21,23H2,1-2H3,(H,40,41)/b36-22+ |
| InChIKey | WQJKUFSGHPOHSI-HPNXWYHWSA-N |
| XLogP | 6.61 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.15 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|