C30H23ClF3N3O4 — CID 162566772
5-[3-(4-chlorophenyl)-7-[[7-(trifluoromethyl)-2,3-dihydrochromen-4-ylidene]carbamoyl]quinoxalin-2-yl]pentanoic acid (PubChem CID 162566772) has the molecular formula C30H23ClF3N3O4 and a molecular weight of 581.98 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)-7-[[7-(trifluoromethyl)-2,3-dihydrochromen-4-ylidene]carbamoyl]quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[3-(4-chlorophenyl)-7-[[7-(trifluoromethyl)-2,3-dihydrochromen-4-ylidene]carbamoyl]quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 162566772 |
| Molecular Formula | C30H23ClF3N3O4 |
| Molecular Weight | 581.98 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | 5-[3-(4-chlorophenyl)-7-[[7-(trifluoromethyl)-2,3-dihydrochromen-4-ylidene]carbamoyl]quinoxalin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2cc(C(=O)/N=C3\CCOc4cc(C(F)(F)F)ccc43)ccc2nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H23ClF3N3O4/c31-20-9-5-17(6-10-20)28-24(3-1-2-4-27(38)39)35-25-15-18(7-12-23(25)36-28)29(40)37-22-13-14-41-26-16-19(30(32,33)34)8-11-21(22)26/h5-12,15-16H,1-4,13-14H2,(H,38,39)/b37-22+ |
| InChIKey | MIPAUUXXOZZGAY-SEBMTOOBSA-N |
| XLogP | 7.18 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.98 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|